Compound Q&A

What is 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5)?

Answer

2-Methyl-4-nitrobenzoic acid
2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) is an aromatic carboxylic acid with a methyl group and a nitro group attached to the benzene ring. Its chemical formula is C7H5NO4, and it is known for its strong acidic properties and potential as a precursor in organic synthesis. The compound is commonly used in research and industrial applications due to its reactivity and functional group versatility.

About

CAS No 1975-51-5
English Name 2-Methyl-4-nitrobenzoic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)O
InChIKey XXXOBNJIIZQSPT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5)?

2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) is primarily used in pharmaceutical research for the d...

Compound Q&A

Is 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) safe?

2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) is generally considered safe when handled properly, bu...

Compound Q&A

How should 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) be stored?

2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) should be stored in a cool, dry, and dark place to mai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...