Compound Q&A

What are the main uses of (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4)?

Answer

(2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1)
The compound (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) is primarily used in pharmaceutical research as a potential ligand for metal complexes. It also finds applications in the synthesis of various derivatives and in industrial processes involving chelation or polymerization. Its use in food and consumer products is limited due to its chemical complexity and potential for non-food-grade applications.

About

CAS No 71607-32-4
English Name (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1)
Molecular Formula C20H20O9
Molecular Weight 404.37 g/mol
SMILES CC1=CC=C(C=C1)C(=O)OC(C(C(=O)O)OC(=O)C2=CC=C(C=C2)C)C(=O)O.O
InChIKey FOTRUJUPLHRVNU-MOGJOVFKSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4)?

The compound (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1), with CAS number 71607...

Compound Q&A

Is (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4) safe?

The safety of (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) depends on its applic...

Compound Q&A

How should (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4) be stored?

To maintain stability, (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) should be st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...