Compound Q&A

What is (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4)?

Answer

(2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1)
The compound (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1), with CAS number 71607-32-4, is a diester of succinic acid. It contains two (4-methylbenzoyl)oxy groups attached to the succinic acid backbone and is known to exist in a 1:1 hydration ratio. This compound is typically used in specialized chemical applications due to its unique structural properties and potential for forming complexes with metal ions.

About

CAS No 71607-32-4
English Name (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1)
Molecular Formula C20H20O9
Molecular Weight 404.37 g/mol
SMILES CC1=CC=C(C=C1)C(=O)OC(C(C(=O)O)OC(=O)C2=CC=C(C=C2)C)C(=O)O.O
InChIKey FOTRUJUPLHRVNU-MOGJOVFKSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4)?

The compound (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) is primarily used in p...

Compound Q&A

Is (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4) safe?

The safety of (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) depends on its applic...

Compound Q&A

How should (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) (CAS: 71607-32-4) be stored?

To maintain stability, (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) should be st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...