Compound Q&A

What are the main uses of 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8)?

Answer

2-Amino-5-methylbenzenesulfonic acid
2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the production of dyes, pigments, and agrochemicals. Additionally, it is used in research for developing new materials and in the food industry as a flavor enhancer. Its versatility makes it valuable across multiple sectors.

About

CAS No 88-44-8
English Name 2-Amino-5-methylbenzenesulfonic acid
Molecular Formula C7H9NO3S
Molecular Weight 187.22 g/mol
SMILES CC1=CC(=C(C=C1)N)S(=O)(=O)O
InChIKey LTPSRQRIPCVMKQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8)?

2-Amino-5-methylbenzenesulfonic acid, with the CAS number 88-44-8, is an organic compound containing...

Compound Q&A

Is 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) safe?

2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) is generally considered safe when handled proper...

Compound Q&A

How should 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) be stored?

2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) should be stored in a cool, dry, and well-ventil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...