Compound Q&A

What is 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8)?

Answer

2-Amino-5-methylbenzenesulfonic acid
2-Amino-5-methylbenzenesulfonic acid, with the CAS number 88-44-8, is an organic compound containing a sulfonic acid group, an amino group, and a methyl group attached to a benzene ring. It is commonly known as 5-methyl-2-aminobenzenesulfonic acid and has a molecular formula of C7H9NO4S. This compound is a white crystalline solid with acidic properties and is often used as a precursor in chemical synthesis due to its reactivity and functional group versatility.

About

CAS No 88-44-8
English Name 2-Amino-5-methylbenzenesulfonic acid
Molecular Formula C7H9NO3S
Molecular Weight 187.22 g/mol
SMILES CC1=CC(=C(C=C1)N)S(=O)(=O)O
InChIKey LTPSRQRIPCVMKQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8)?

2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) is primarily used in the pharmaceutical industry...

Compound Q&A

Is 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) safe?

2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) is generally considered safe when handled proper...

Compound Q&A

How should 2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) be stored?

2-Amino-5-methylbenzenesulfonic acid (CAS: 88-44-8) should be stored in a cool, dry, and well-ventil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...