Compound Q&A

Is 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) safe?

Answer

2-Hydroxy-5-sulfobenzoic acid
2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is generally considered safe when handled properly and used within regulated limits. However, it may cause mild skin or eye irritation. Safety data sheets (SDS) recommend avoiding inhalation and direct contact, using appropriate personal protective equipment (PPE), and following standard laboratory safety protocols to ensure safe handling and disposal.

About

CAS No 97-05-2
English Name 2-Hydroxy-5-sulfobenzoic acid
Molecular Formula C7H6O6S
Molecular Weight 218.18599999999998 g/mol
SMILES OC(=O)c1cc(ccc1O)S(=O)(=O)O
InChIKey YCPXWRQRBFJBPZ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2)?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is an organic compound with the chemical formula C7H7NO...

Compound Q&A

What are the main uses of 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2)?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is widely utilized in pharmaceuticals as a buffering ag...

Compound Q&A

How should 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) be stored?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) should be stored in a cool, dry place at temperatures b...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...