Compound Q&A

What is 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2)?

Answer

2-Hydroxy-5-sulfobenzoic acid
2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is an organic compound with the chemical formula C7H7NO5S. It contains a hydroxyl group and a sulfonic acid group, making it a versatile chelating agent and surfactant. This compound is commonly used as a pH indicator, such as in methyl red, and exhibits solubility in water with acidic properties at low pH.

About

CAS No 97-05-2
English Name 2-Hydroxy-5-sulfobenzoic acid
Molecular Formula C7H6O6S
Molecular Weight 218.19 g/mol
SMILES OC(=O)c1cc(ccc1O)S(=O)(=O)O
InChIKey YCPXWRQRBFJBPZ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2)?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is widely utilized in pharmaceuticals as a buffering ag...

Compound Q&A

Is 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) safe?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is generally considered safe when handled properly and ...

Compound Q&A

How should 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) be stored?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) should be stored in a cool, dry place at temperatures b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...