Compound Q&A

What is 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2)?

Answer

2-Hydroxy-5-sulfobenzoic acid
2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is an organic compound with the chemical formula C7H7NO5S. It contains a hydroxyl group and a sulfonic acid group, making it a versatile chelating agent and surfactant. This compound is commonly used as a pH indicator, such as in methyl red, and exhibits solubility in water with acidic properties at low pH.

About

CAS No 97-05-2
English Name 2-Hydroxy-5-sulfobenzoic acid
Molecular Formula C7H6O6S
Molecular Weight 218.18599999999998 g/mol
SMILES OC(=O)c1cc(ccc1O)S(=O)(=O)O
InChIKey YCPXWRQRBFJBPZ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2)?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is widely utilized in pharmaceuticals as a buffering ag...

Compound Q&A

Is 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) safe?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) is generally considered safe when handled properly and ...

Compound Q&A

How should 2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) be stored?

2-Hydroxy-5-sulfobenzoic acid (CAS: 97-05-2) should be stored in a cool, dry place at temperatures b...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...