Compound Q&A

What are the main uses of 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8)?

Answer

4-Methoxy-3-nitrobenzoic acid
4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in the synthesis of dyes, agrochemicals, and materials. Its unique combination of functional groups makes it valuable in organic chemistry for creating derivatives with specific biological or industrial properties.

About

CAS No 89-41-8
English Name 4-Methoxy-3-nitrobenzoic acid
Molecular Formula C8H7NO5
Molecular Weight 197.14 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey ANXBDAFDZSXOPQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8)?

4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) is an organic compound with the chemical formula C8H7NO...

Compound Q&A

Is 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) safe?

4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) is generally considered safe when handled properly. How...

Compound Q&A

How should 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) be stored?

4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) should be stored in a cool, dry, and well-ventilated ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...