Compound Q&A

What is 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8)?

Answer

4-Methoxy-3-nitrobenzoic acid
4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) is an organic compound with the chemical formula C8H7NO5. It is a benzoic acid derivative containing both methoxy and nitro functional groups. This compound is known for its aromatic structure and exhibits moderate solubility in organic solvents. It is commonly used as an intermediate in chemical synthesis due to its reactivity and functional group versatility.

About

CAS No 89-41-8
English Name 4-Methoxy-3-nitrobenzoic acid
Molecular Formula C8H7NO5
Molecular Weight 197.14 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey ANXBDAFDZSXOPQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8)?

4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) is primarily used in pharmaceutical research as a build...

Compound Q&A

Is 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) safe?

4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) is generally considered safe when handled properly. How...

Compound Q&A

How should 4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) be stored?

4-Methoxy-3-nitrobenzoic acid (CAS: 89-41-8) should be stored in a cool, dry, and well-ventilated ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...