Compound Q&A

What is TMB dihydrochloride (CAS: 64285-73-0)?

Answer

TMB dihydrochloride
TMB dihydrochloride, with the CAS number 64285-73-0, is a chemical compound commonly used as a chromogenic substrate in biochemical assays. It has the molecular formula C10H13N3O2·2HCl and is known for its stability in aqueous solutions. This compound is typically yellow in color and has a molecular weight of approximately 273.7 g/mol. It is widely recognized for its role in enzyme-linked immunosorbent assays (ELISA) and other diagnostic applications due to its strong absorption properties in the visible spectrum.

About

CAS No 64285-73-0
English Name TMB dihydrochloride
Molecular Formula C16H22Cl2N2
Molecular Weight 313.3 g/mol
SMILES CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)N)C.Cl.Cl
InChIKey NYNRGZULARUZCC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of TMB dihydrochloride (CAS: 64285-73-0)?

TMB dihydrochloride is primarily used in enzyme-linked immunosorbent assays (ELISA) as a chromogenic...

Compound Q&A

Is TMB dihydrochloride (CAS: 64285-73-0) safe?

TMB dihydrochloride is generally considered safe when handled properly, but it should be treated wit...

Compound Q&A

How should TMB dihydrochloride (CAS: 64285-73-0) be stored?

TMB dihydrochloride should be stored in a cool, dry place away from direct light. It is typically ke...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...