Compound Q&A

What are the main uses of (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7)?

Answer

(1beta,3beta,25R)-Spirost-5-en-1,3-diol
(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) is primarily used in pharmaceutical research as a precursor for drug development due to its biological activity. It also serves as an industrial chemical intermediate and is studied for potential applications in natural products chemistry. Its unique structure makes it valuable for exploring therapeutic properties in medicinal and scientific contexts.

About

CAS No 472-11-7
English Name (1beta,3beta,25R)-Spirost-5-en-1,3-diol
Molecular Formula C27H42O4
Molecular Weight 430.63 g/mol
SMILES C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5([C@@H](C[C@@H](C6)O)O)C)C)C)OC1
InChIKey QMQIQBOGXYYATH-IDABPMKMSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7)?

(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) is a steroidal saponin compound with the ch...

Compound Q&A

Is (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) safe?

(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) is generally considered safe when handled p...

Compound Q&A

How should (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) be stored?

(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...