Compound Q&A

What is (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7)?

Answer

(1beta,3beta,25R)-Spirost-5-en-1,3-diol
(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) is a steroidal saponin compound with the chemical formula C27H46O3. It is characterized by a spiro ring system and two hydroxyl groups at positions 1 and 3. This compound is commonly found in natural sources and exhibits specific physical properties, including solubility in organic solvents and a crystalline structure.

About

CAS No 472-11-7
English Name (1beta,3beta,25R)-Spirost-5-en-1,3-diol
Molecular Formula C27H42O4
Molecular Weight 430.63 g/mol
SMILES C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5([C@@H](C[C@@H](C6)O)O)C)C)C)OC1
InChIKey QMQIQBOGXYYATH-IDABPMKMSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7)?

(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) is primarily used in pharmaceutical researc...

Compound Q&A

Is (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) safe?

(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) is generally considered safe when handled p...

Compound Q&A

How should (1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) be stored?

(1beta,3beta,25R)-Spirost-5-en-1,3-diol (CAS: 472-11-7) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...