Compound Q&A

What are the main uses of 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7)?

Answer

2,3-dimethyl-4-nitropyridin-1-ium-1-olate
2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) is primarily used in pharmaceutical research as a building block for drug development. It also serves in agrochemicals and dye production due to its functional groups. Additionally, it is employed in organic chemistry for synthesizing nitrogen-containing compounds and as a reagent in catalytic processes. Its applications are closely tied to its chemical reactivity and structural versatility.

About

CAS No 37699-43-7
English Name 2,3-dimethyl-4-nitropyridin-1-ium-1-olate
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES CC1=C(C=C[N+](=C1C)[O-])[N+](=O)[O-]
InChIKey CFMTVTYBZMKULI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7)?

2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) is a pyridine derivative with the chemic...

Compound Q&A

Is 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) safe?

2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) requires careful handling due to its pot...

Compound Q&A

How should 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) be stored?

2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) should be stored in a cool, dry place (i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...