Compound Q&A

What is 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7)?

Answer

2,3-dimethyl-4-nitropyridin-1-ium-1-olate
2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) is a pyridine derivative with the chemical formula C7H7N2O3. It is a yellow solid characterized by its nitro group and zwitterionic structure, commonly used as an intermediate in organic synthesis. The compound exhibits moderate solubility in polar solvents and is known for its reactivity in chemical reactions involving electrophilic substitution.

About

CAS No 37699-43-7
English Name 2,3-dimethyl-4-nitropyridin-1-ium-1-olate
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES CC1=C(C=C[N+](=C1C)[O-])[N+](=O)[O-]
InChIKey CFMTVTYBZMKULI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7)?

2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) is primarily used in pharmaceutical rese...

Compound Q&A

Is 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) safe?

2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) requires careful handling due to its pot...

Compound Q&A

How should 2,3-dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) be stored?

2,3-Dimethyl-4-nitropyridin-1-ium-1-olate (CAS: 37699-43-7) should be stored in a cool, dry place (i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...