Compound Q&A

What is (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid (CAS: 52950-18-2)?

Answer

(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid
(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid, with CAS number 52950-18-2, is a chiral organic compound belonging to the class of hydroxyacetic acids. It has the chemical formula C8H9ClO3 and is characterized by its hydroxyl and carboxylic acid functional groups. This compound is known for its potential applications in medicinal chemistry due to its structural versatility and reactivity.

About

CAS No 52950-18-2
English Name (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES C1=CC=C(C(=C1)C(C(=O)O)O)Cl
InChIKey RWOLDZZTBNYTMS-SSDOTTSWSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid (CAS: 52950-18-2)?

(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid is primarily used in pharmaceutical research as a build...

Compound Q&A

Is (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid (CAS: 52950-18-2) safe?

The safety of (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid depends on exposure conditions and handli...

Compound Q&A

How should (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid (CAS: 52950-18-2) be stored?

(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid should be stored in a cool, dry, and well-ventilated ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...