Compound Q&A

How should N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2) be stored?

Answer

N-Benzyl-N,N-dimethyl-1-decanaminium chloride
N-Benzyl-N,N-dimethyl-1-decanaminium chloride should be stored in a cool, dry, and well-ventilated area, away from direct light. It is typically kept in airtight containers to prevent moisture absorption. Maintaining storage conditions below 25°C and ensuring low humidity levels are essential for preserving its stability and effectiveness over time.

About

CAS No 63449-41-2
English Name N-Benzyl-N,N-dimethyl-1-decanaminium chloride
Molecular Formula C19H34ClN
Molecular Weight 311.93 g/mol
EINECS 264-151-6
SMILES CCCCCCCCCC[N+](Cc1ccccc1)(C)C.[Cl-]
InChIKey TTZLKXKJIMOHHG-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2)?

N-Benzyl-N,N-dimethyl-1-decanaminium chloride is a quaternary ammonium compound with the chemical fo...

Compound Q&A

What are the main uses of N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2)?

N-Benzyl-N,N-dimethyl-1-decanaminium chloride is primarily used in pharmaceuticals as a cationic sur...

Compound Q&A

Is N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2) safe?

N-Benzyl-N,N-dimethyl-1-decanaminium chloride is generally considered safe when handled properly. Ho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...