Compound Q&A

Is N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2) safe?

Answer

N-Benzyl-N,N-dimethyl-1-decanaminium chloride
N-Benzyl-N,N-dimethyl-1-decanaminium chloride is generally considered safe when handled properly. However, it should be treated with caution as it may cause skin and eye irritation. Protective measures such as gloves, goggles, and proper ventilation are recommended. Safety standards and guidelines should be followed to ensure safe use in both laboratory and industrial environments.

About

CAS No 63449-41-2
English Name N-Benzyl-N,N-dimethyl-1-decanaminium chloride
Molecular Formula C19H34ClN
Molecular Weight 311.93 g/mol
EINECS 264-151-6
SMILES CCCCCCCCCC[N+](Cc1ccccc1)(C)C.[Cl-]
InChIKey TTZLKXKJIMOHHG-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2)?

N-Benzyl-N,N-dimethyl-1-decanaminium chloride is a quaternary ammonium compound with the chemical fo...

Compound Q&A

What are the main uses of N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2)?

N-Benzyl-N,N-dimethyl-1-decanaminium chloride is primarily used in pharmaceuticals as a cationic sur...

Compound Q&A

How should N-Benzyl-N,N-dimethyl-1-decanaminium chloride (CAS: 63449-41-2) be stored?

N-Benzyl-N,N-dimethyl-1-decanaminium chloride should be stored in a cool, dry, and well-ventilated a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...