Compound Q&A

What are the main uses of 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6)?

Answer

3,4,5-Trimethoxyphenylacetic acid
3,4,5-Trimethoxyphenylacetic acid is primarily used in pharmaceutical research for the development of drug candidates. It also finds applications in organic synthesis as a building block for more complex molecules. Additionally, it is used in the fragrance and flavor industry due to its aromatic properties, and in research settings for analytical and structural studies.

About

CAS No 951-82-6
English Name 3,4,5-Trimethoxyphenylacetic acid
Molecular Formula C11H14O5
Molecular Weight 226.23 g/mol
SMILES COC1=CC(=CC(=C1OC)OC)CC(=O)O
InChIKey DDSJXCGGOXKGSJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6)?

3,4,5-Trimethoxyphenylacetic acid is an organic compound with the chemical formula C12H14O6. It is a...

Compound Q&A

Is 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6) safe?

3,4,5-Trimethoxyphenylacetic acid is generally considered safe when handled properly. However, as wi...

Compound Q&A

How should 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6) be stored?

3,4,5-Trimethoxyphenylacetic acid should be stored in a cool, dry place away from direct light. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...