Compound Q&A

What is 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6)?

Answer

3,4,5-Trimethoxyphenylacetic acid
3,4,5-Trimethoxyphenylacetic acid is an organic compound with the chemical formula C12H14O6. It is a derivative of phenylacetic acid, featuring three methoxy groups (-OCH3) at the 3, 4, and 5 positions on the phenyl ring. This compound is known for its aromatic structure and is often used in various chemical applications due to its stability and reactivity.

About

CAS No 951-82-6
English Name 3,4,5-Trimethoxyphenylacetic acid
Molecular Formula C11H14O5
Molecular Weight 226.23 g/mol
SMILES COC1=CC(=CC(=C1OC)OC)CC(=O)O
InChIKey DDSJXCGGOXKGSJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6)?

3,4,5-Trimethoxyphenylacetic acid is primarily used in pharmaceutical research for the development o...

Compound Q&A

Is 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6) safe?

3,4,5-Trimethoxyphenylacetic acid is generally considered safe when handled properly. However, as wi...

Compound Q&A

How should 3,4,5-Trimethoxyphenylacetic acid (CAS: 951-82-6) be stored?

3,4,5-Trimethoxyphenylacetic acid should be stored in a cool, dry place away from direct light. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...