Compound Q&A

What are the main uses of Sophocarpine monohydrate (CAS: 145572-44-7)?

Answer

Sophocarpine monohydrate
Sophocarpine monohydrate (CAS: 145572-44-7) is primarily used in pharmaceuticals as a research compound for its potential antitumor, anti-inflammatory, and antiviral effects. It also finds applications in traditional medicine for treating spasms and gastrointestinal disorders. In scientific research, it serves as a tool for studying alkaloid mechanisms and drug development. Its use in food or industrial sectors is limited due to low bioavailability and specific handling requirements.

About

English Name Sophocarpine monohydrate
Molecular Formula C15H24N2O2
Molecular Weight 264.37 g/mol
SMILES O=C1C=CC[C@]2([H])[C@@]3([H])CCCN4[C@@]3([H])[C@](CCC4)([H])CN21.[H]O[H]
InChIKey FBOREIYHDGYUFA-PUILLJIJSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Sophocarpine monohydrate (CAS: 145572-44-7)?

Sophocarpine monohydrate (CAS: 145572-44-7) is a quinolizidine alkaloid derivative with the chemical...

Compound Q&A

Is Sophocarpine monohydrate (CAS: 145572-44-7) safe?

Sophocarpine monohydrate (CAS: 145572-44-7) is generally considered safe when used in controlled pha...

Compound Q&A

How should Sophocarpine monohydrate (CAS: 145572-44-7) be stored?

Sophocarpine monohydrate (CAS: 145572-44-7) should be stored in a cool, dry place (below 25°C), away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...