Compound Q&A

What is Sophocarpine monohydrate (CAS: 145572-44-7)?

Answer

Sophocarpine monohydrate
Sophocarpine monohydrate (CAS: 145572-44-7) is a quinolizidine alkaloid derivative with the chemical formula C15H21NO4·H2O. It is a white crystalline solid known for its anticholinergic and antispasmodic properties, commonly used in pharmaceutical research. The compound exhibits solubility in water and ethanol, with a melting point around 150–155°C. Its structure includes a pyridine ring and a hydroxyl group, contributing to its pharmacological activity.

About

English Name Sophocarpine monohydrate
Molecular Formula C15H24N2O2
Molecular Weight 264.37 g/mol
SMILES O=C1C=CC[C@]2([H])[C@@]3([H])CCCN4[C@@]3([H])[C@](CCC4)([H])CN21.[H]O[H]
InChIKey FBOREIYHDGYUFA-PUILLJIJSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Sophocarpine monohydrate (CAS: 145572-44-7)?

Sophocarpine monohydrate (CAS: 145572-44-7) is primarily used in pharmaceuticals as a research compo...

Compound Q&A

Is Sophocarpine monohydrate (CAS: 145572-44-7) safe?

Sophocarpine monohydrate (CAS: 145572-44-7) is generally considered safe when used in controlled pha...

Compound Q&A

How should Sophocarpine monohydrate (CAS: 145572-44-7) be stored?

Sophocarpine monohydrate (CAS: 145572-44-7) should be stored in a cool, dry place (below 25°C), away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...