Compound Q&A

What are the main uses of Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate (CAS: 131274-22-1)?

Answer

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate
Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate is primarily used as a catalyst in pharmaceutical and industrial processes. It finds applications in the synthesis of complex organic molecules, including those used in drug development. Additionally, it is employed in research for its ability to facilitate specific chemical reactions under controlled conditions.

About

English Name Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate
Molecular Formula C12H28BF4P
Molecular Weight 290.13 g/mol
SMILES [B-](F)(F)(F)F.CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C
InChIKey YTJUCJAUJCXFTN-UHFFFAOYSA-O
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate (CAS: 131274-22-1)?

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate is a phosphonium salt with the chemical formu...

Compound Q&A

Is Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate (CAS: 131274-22-1) safe?

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate is generally considered safe when handled pro...

Compound Q&A

How should Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate ( CAS: 131274-22-1 ) be stored?

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate should be stored in a cool, dry, and well-ven...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...