Compound Q&A

What is Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate (CAS: 131274-22-1)?

Answer

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate
Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate is a phosphonium salt with the chemical formula C12H27BF4OP. It is a colorless solid that is commonly used as a catalyst in organic synthesis. The compound is known for its stability and low toxicity, making it suitable for various chemical applications.

About

English Name Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate
Molecular Formula C12H28BF4P
Molecular Weight 290.13 g/mol
SMILES [B-](F)(F)(F)F.CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C
InChIKey YTJUCJAUJCXFTN-UHFFFAOYSA-O
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate (CAS: 131274-22-1)?

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate is primarily used as a catalyst in pharmaceut...

Compound Q&A

Is Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate (CAS: 131274-22-1) safe?

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate is generally considered safe when handled pro...

Compound Q&A

How should Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate ( CAS: 131274-22-1 ) be stored?

Tris(2-methyl-2-propanyl)phosphonium tetrafluoroborate should be stored in a cool, dry, and well-ven...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...