Compound Q&A

How should (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1) be stored?

Answer

(2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
This compound should be stored in a cool, dry, and dark place to maintain stability. Keep it in airtight, moisture-proof containers to prevent degradation. Avoid exposure to high humidity, heat, or light. Ensure storage away from incompatible materials like strong acids or bases. Maintain proper labeling and follow recommended preservation methods for chemical safety and longevity.

About

CAS No 6645-46-1
English Name (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C7H16ClNO3
Molecular Weight 197.66 g/mol
SMILES O[C@@H](C[N+](C)(C)C)CC(=O)O.[Cl-]
InChIKey JXXCENBLGFBQJM-FYZOBXCZSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1)?

This compound, with the CAS number 6645-46-1, is a chiral quaternary ammonium salt containing a carb...

Compound Q&A

What are the main uses of (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1)?

This compound is primarily utilized in pharmaceutical applications for the synthesis of chiral drugs...

Compound Q&A

Is (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1) safe?

Safety of this compound depends on proper handling. It is generally considered safe when used in acc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...