Compound Q&A

What is (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1)?

Answer

(2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
This compound, with the CAS number 6645-46-1, is a chiral quaternary ammonium salt containing a carboxylic acid group, a hydroxyl group, and three methyl substituents on the nitrogen atom. Its chemical formula is C6H14ClNO2, and it exhibits typical amine-like properties with a pungent odor. It is commonly used as a synthetic intermediate in pharmaceutical and chemical research due to its functional group versatility.

About

CAS No 6645-46-1
English Name (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C7H16ClNO3
Molecular Weight 197.66 g/mol
SMILES O[C@@H](C[N+](C)(C)C)CC(=O)O.[Cl-]
InChIKey JXXCENBLGFBQJM-FYZOBXCZSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1)?

This compound is primarily utilized in pharmaceutical applications for the synthesis of chiral drugs...

Compound Q&A

Is (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1) safe?

Safety of this compound depends on proper handling. It is generally considered safe when used in acc...

Compound Q&A

How should (2R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 6645-46-1) be stored?

This compound should be stored in a cool, dry, and dark place to maintain stability. Keep it in airt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...