Compound Q&A

How should Fusidic acid sodium salt (CAS: 751-94-0) be stored?

Answer

Fusidic acid sodium salt
Fusidic acid sodium salt (CAS: 751-94-0) should be stored in a cool, dry place away from direct sunlight. It is stable under normal storage conditions but should be kept in a sealed container to prevent moisture ingress. Maintaining appropriate temperature and humidity levels is crucial for preserving its potency and effectiveness.

About

CAS No 751-94-0
English Name Fusidic acid sodium salt
Molecular Formula C31H47NaO6
Molecular Weight 538.7 g/mol
SMILES CC1C2CCC3(C(C2(CCC1O)C)C(CC4C3(CC(C4=C(CCC=C(C)C)C(=O)[O-])OC(=O)C)C)O)C.[Na+]
InChIKey HJHVQCXHVMGZNC-JCJNLNMISA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Fusidic acid sodium salt (CAS: 751-94-0)?

Fusidic acid sodium salt (CAS: 751-94-0) is an antibiotic compound used in pharmaceutical applicatio...

Compound Q&A

What are the main uses of Fusidic acid sodium salt (CAS: 751-94-0)?

Fusidic acid sodium salt (CAS: 751-94-0) is primarily used as an antibiotic in veterinary medicine t...

Compound Q&A

Is Fusidic acid sodium salt (CAS: 751-94-0) safe?

Fusidic acid sodium salt (CAS: 751-94-0) is generally considered safe when used as directed, but it ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...