Compound Q&A

What is Fusidic acid sodium salt (CAS: 751-94-0)?

Answer

Fusidic acid sodium salt
Fusidic acid sodium salt (CAS: 751-94-0) is an antibiotic compound used in pharmaceutical applications. It has the chemical formula C24H42NO5 and is known for its antibacterial properties. This compound is derived from fusidic acid, which is naturally produced by the bacterium *Streptomyces* and is commonly used in veterinary medicine and human treatments for bacterial infections.

About

CAS No 751-94-0
English Name Fusidic acid sodium salt
Molecular Formula C31H47NaO6
Molecular Weight 538.7 g/mol
SMILES CC1C2CCC3(C(C2(CCC1O)C)C(CC4C3(CC(C4=C(CCC=C(C)C)C(=O)[O-])OC(=O)C)C)O)C.[Na+]
InChIKey HJHVQCXHVMGZNC-JCJNLNMISA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Fusidic acid sodium salt (CAS: 751-94-0)?

Fusidic acid sodium salt (CAS: 751-94-0) is primarily used as an antibiotic in veterinary medicine t...

Compound Q&A

Is Fusidic acid sodium salt (CAS: 751-94-0) safe?

Fusidic acid sodium salt (CAS: 751-94-0) is generally considered safe when used as directed, but it ...

Compound Q&A

How should Fusidic acid sodium salt (CAS: 751-94-0) be stored?

Fusidic acid sodium salt (CAS: 751-94-0) should be stored in a cool, dry place away from direct sunl...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...