Compound Q&A

What are the main uses of (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4)?

Answer

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one
(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) is primarily used in pharmaceutical and biochemical research. It serves as an intermediate in the synthesis of various steroid hormones and has applications in the development of anabolic agents. Additionally, it is used in laboratory settings for studying metabolic pathways and steroid metabolism.

About

CAS No 58-18-4
English Name (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one
Molecular Formula C20H30O2
Molecular Weight 302.46 g/mol
SMILES C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C
InChIKey GCKMFJBGXUYNAG-HLXURNFRSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4)?

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) is a synthetic steroid compound wit...

Compound Q&A

Is (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) safe?

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) is generally considered safe when h...

Compound Q&A

How should (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) be stored?

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...