Compound Q&A

What is (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4)?

Answer

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one
(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) is a synthetic steroid compound with the molecular formula C21H32O3. It is known for its structural similarity to androstane derivatives and exhibits specific physicochemical properties, including solubility in organic solvents and a melting point around 140-142 °C. This compound is often studied in biochemical research due to its potential role in hormone-related processes.

About

CAS No 58-18-4
English Name (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one
Molecular Formula C20H30O2
Molecular Weight 302.46 g/mol
SMILES C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C
InChIKey GCKMFJBGXUYNAG-HLXURNFRSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4)?

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) is primarily used in pharmaceutical...

Compound Q&A

Is (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) safe?

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) is generally considered safe when h...

Compound Q&A

How should (17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) be stored?

(17alpha)-17-Hydroxy-17-methylandrost-4-en-3-one (CAS: 58-18-4) should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...