Compound Q&A

What are the main uses of 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8)?

Answer

2-Amino-2-deoxy-D-glucose
2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) is primarily used in pharmaceuticals as a precursor for antibiotics like neomycin. It also plays a role in research related to carbohydrate metabolism and glycosylation studies. In industrial applications, it may be used in bio-based material development. Additionally, it is explored in the food industry for potential functional applications, though its use is limited compared to other sugar derivatives.

About

CAS No 3416-24-8
English Name 2-Amino-2-deoxy-D-glucose
Molecular Formula C6H13NO5
Molecular Weight 179.17 g/mol
SMILES N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO
InChIKey FZHXIRIBWMQPQF-SLPGGIOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8)?

2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) is an amino sugar derivative with the chemical formula C6...

Compound Q&A

Is 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) safe?

2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) is generally considered safe when handled properly in con...

Compound Q&A

How should 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) be stored?

2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) should be stored in a cool, dry place (ideally 2-8°C), aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...