Compound Q&A

What is 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8)?

Answer

2-Amino-2-deoxy-D-glucose
2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) is an amino sugar derivative with the chemical formula C6H13NO5. It is structurally similar to glucose but lacks an oxygen atom and contains an amino group. This compound is known for its role in biochemical pathways and is used as a key intermediate in pharmaceutical synthesis. Its molecular characteristics include solubility in water and a white crystalline appearance.

About

CAS No 3416-24-8
English Name 2-Amino-2-deoxy-D-glucose
Molecular Formula C6H13NO5
Molecular Weight 179.17 g/mol
SMILES N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO
InChIKey FZHXIRIBWMQPQF-SLPGGIOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8)?

2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) is primarily used in pharmaceuticals as a precursor for a...

Compound Q&A

Is 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) safe?

2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) is generally considered safe when handled properly in con...

Compound Q&A

How should 2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) be stored?

2-Amino-2-deoxy-D-glucose (CAS: 3416-24-8) should be stored in a cool, dry place (ideally 2-8°C), aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...