Compound Q&A

What are the main uses of 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8)?

Answer

2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione
2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (104206-82-8) is primarily used in pharmaceutical research for the development of potential drug candidates. It may also serve as an intermediate in synthetic chemistry, particularly in the creation of complex organic molecules. Its use in industry and food is limited due to its chemical reactivity and potential toxicity.

About

English Name 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione
Molecular Formula C14H13NO7S
Molecular Weight 339.32 g/mol
SMILES CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(c1)[N+](=O)[O-]
InChIKey KPUREKXXPHOJQT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8)?

2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8) is an organic compound...

Compound Q&A

Is 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8) safe?

The safety of 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (104206-82-8) depends on it...

Compound Q&A

How should 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8) be stored?

2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (104206-82-8) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...