Compound Q&A

What is 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8)?

Answer

2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione
2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8) is an organic compound containing a cyclohexanedione moiety and a substituted benzoyl group. It is known for its structural complexity and potential applications in chemical research. The compound exhibits specific chemical properties, including solubility in organic solvents and a characteristic molecular weight of approximately 328.36 g/mol.

About

English Name 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione
Molecular Formula C14H13NO7S
Molecular Weight 339.32 g/mol
SMILES CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(c1)[N+](=O)[O-]
InChIKey KPUREKXXPHOJQT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8)?

2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (104206-82-8) is primarily used in pharma...

Compound Q&A

Is 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8) safe?

The safety of 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (104206-82-8) depends on it...

Compound Q&A

How should 2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (CAS: 104206-82-8) be stored?

2-[4-(Methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione (104206-82-8) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...