Compound Q&A

Is Cynarin (CAS: 30964-13-7) safe?

Answer

Cynarin
Cynarin is generally considered safe for normal use, with a low toxicity profile. However, handling should follow standard chemical safety protocols to avoid irritation. Regulatory standards classify it as safe when used as directed, though high concentrations may require caution in specific applications.

About

CAS No 30964-13-7
English Name Cynarin
Molecular Formula C25H24O12
Molecular Weight 516.45 g/mol
SMILES O=C(O[C@@H]1C[C@](OC(=O)/C=C/c2ccc(c(c2)O)O)(C[C@H]([C@@H]1O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O
InChIKey YDDUMTOHNYZQPO-RVXRWRFUSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Cynarin (CAS: 30964-13-7)?

Cynarin is a natural flavonoid glycoside known for its bitter taste and potential health benefits. W...

Compound Q&A

What are the main uses of Cynarin (CAS: 30964-13-7)?

Cynarin is primarily used in pharmaceuticals as a bioactive compound for its antioxidant effects. It...

Compound Q&A

How should Cynarin (CAS: 30964-13-7) be stored?

Cynarin should be stored in a cool, dry place, away from direct light. It is hygroscopic, so airtigh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...