Compound Q&A

What are the main uses of Diphenyl[(2R)-2-pyrrolidinyl]methanol (CAS: 22348-32-9)?

Answer

Diphenyl[(2R)-2-pyrrolidinyl]methanol
Diphenyl[(2R)-2-pyrrolidinyl]methanol is primarily used in pharmaceutical research for the development of drugs targeting central nervous system disorders. It serves as an intermediate in the synthesis of various biologically active compounds. Additionally, it finds applications in organic synthesis and as a reagent in chemical research due to its unique structure and functional groups. Its use in industry and food is limited due to potential toxicity and regulatory restrictions.

About

CAS No 22348-32-9
English Name Diphenyl[(2R)-2-pyrrolidinyl]methanol
Molecular Formula C17H19NO
Molecular Weight 253.34 g/mol
SMILES C1CC(NC1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O
InChIKey OGCGXUGBDJGFFY-MRXNPFEDSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Diphenyl[(2R)-2-pyrrolidinyl]methanol (CAS: 22348-32-9)?

Diphenyl[(2R)-2-pyrrolidinyl]methanol is a chemical compound with the CAS number 22348-32-9. It is a...

Compound Q&A

Is Diphenyl[(2R)-2-pyrrolidinyl]methanol (CAS: 22348-32-9) safe?

Diphenyl[(2R)-2-pyrrolidinyl]methanol is considered toxic and should be handled with care. It may ca...

Compound Q&A

How should Diphenyl[(2R)-2-pyrrolidinyl]methanol (CAS: 22348-32-9) be stored?

Diphenyl[(2R)-2-pyrrolidinyl]methanol should be stored in a cool, dry, and dark place to maintain it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...