Compound Q&A

How should Pneumocandin B0 (CAS: 135575-42-7) be stored?

Answer

Pneumocandin B0
Pneumocandin B0 should be stored in a cool, dry place away from direct light. It is typically kept in airtight containers at a temperature range of 2-8°C. Maintaining stable humidity levels and ensuring proper ventilation are essential to preserve its chemical integrity and effectiveness.

About

English Name Pneumocandin B0
Molecular Formula C39H61N7O8
Molecular Weight 755.96 g/mol
SMILES CCC(CC(CCCCCCCCC(=O)N[C@H]1C[CH][CH]NC(=O)[C@@H]2[CH]CCN2C(=O)[CH]NC(=O)[CH]NC(=O)[C@H]2N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[CH]C2)C)C
InChIKey RQTRJXDLZXZUIA-ITUYXABCSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Pneumocandin B0 (CAS: 135575-42-7)?

Pneumocandin B0 is a natural antibiotic compound derived from the fermentation of *Streptomyces* spe...

Compound Q&A

What are the main uses of Pneumocandin B0 (CAS: 135575-42-7)?

Pneumocandin B0 is primarily used in pharmaceutical research for the development of antifungal drugs...

Compound Q&A

Is Pneumocandin B0 (CAS: 135575-42-7) safe?

Pneumocandin B0 is generally considered safe when handled properly in controlled laboratory environm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...