Compound Q&A

What are the main uses of Pneumocandin B0 (CAS: 135575-42-7)?

Answer

Pneumocandin B0
Pneumocandin B0 is primarily used in pharmaceutical research for the development of antifungal drugs, such as caspofungin. It also finds applications in medicinal chemistry and biotechnology for studying fungal inhibition mechanisms and as a starting material for drug synthesis.

About

English Name Pneumocandin B0
Molecular Formula C39H61N7O8
Molecular Weight 755.96 g/mol
SMILES CCC(CC(CCCCCCCCC(=O)N[C@H]1C[CH][CH]NC(=O)[C@@H]2[CH]CCN2C(=O)[CH]NC(=O)[CH]NC(=O)[C@H]2N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[CH]C2)C)C
InChIKey RQTRJXDLZXZUIA-ITUYXABCSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Pneumocandin B0 (CAS: 135575-42-7)?

Pneumocandin B0 is a natural antibiotic compound derived from the fermentation of *Streptomyces* spe...

Compound Q&A

Is Pneumocandin B0 (CAS: 135575-42-7) safe?

Pneumocandin B0 is generally considered safe when handled properly in controlled laboratory environm...

Compound Q&A

How should Pneumocandin B0 (CAS: 135575-42-7) be stored?

Pneumocandin B0 should be stored in a cool, dry place away from direct light. It is typically kept i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...