Compound Q&A

What are the main uses of 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4)?

Answer

2,4-Dichloro-5-sulfamoylbenzoic acid
2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) is primarily used as an intermediate in the synthesis of pharmaceuticals, particularly antibiotics and anti-inflammatory agents. It also finds applications in agrochemicals, dye manufacturing, and research for developing new chemical compounds. Its sulfamoyl group contributes to its utility in drug design and functional chemistry.

About

CAS No 2736-23-4
English Name 2,4-Dichloro-5-sulfamoylbenzoic acid
Molecular Formula C7H5Cl2NO4S
Molecular Weight 270.09 g/mol
SMILES C1=C(C(=CC(=C1S(=O)(=O)N)Cl)Cl)C(=O)O
InChIKey ZSHHRBYVHTVRFK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4)?

2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) is an organic compound with the chemical formu...

Compound Q&A

Is 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) safe?

2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) requires careful handling due to its potential...

Compound Q&A

How should 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) be stored?

2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) should be stored in airtight, moisture-proof c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...