Compound Q&A

What is 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4)?

Answer

2,4-Dichloro-5-sulfamoylbenzoic acid
2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) is an organic compound with the chemical formula C7H5Cl2N2O3S. It features a benzene ring substituted with two chlorine atoms at positions 2 and 4, and a sulfamoyl group at position 5. This compound is typically a white solid with moderate solubility in polar solvents. Its structure makes it relevant in chemical synthesis and pharmaceutical research.

About

CAS No 2736-23-4
English Name 2,4-Dichloro-5-sulfamoylbenzoic acid
Molecular Formula C7H5Cl2NO4S
Molecular Weight 270.09299999999996 g/mol
SMILES C1=C(C(=CC(=C1S(=O)(=O)N)Cl)Cl)C(=O)O
InChIKey ZSHHRBYVHTVRFK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4)?

2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) is primarily used as an intermediate in the sy...

Compound Q&A

Is 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) safe?

2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) requires careful handling due to its potential...

Compound Q&A

How should 2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) be stored?

2,4-Dichloro-5-sulfamoylbenzoic acid (CAS: 2736-23-4) should be stored in airtight, moisture-proof c...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...