Compound Q&A

What is 2'-O-Methyluridine (CAS: 2140-76-3)?

Answer

2'-O-Methyluridine
2'-O-Methyluridine is a modified nucleoside with the chemical formula C10H14N2O5. It is structurally similar to uridine but features an additional methyl group on the 2' oxygen atom of the ribose ring. This compound is commonly used in molecular biology and pharmaceutical research due to its unique chemical properties and stability compared to natural nucleosides.

About

CAS No 2140-76-3
English Name 2'-O-Methyluridine
Molecular Formula C10H14N2O6
Molecular Weight 258.23 g/mol
SMILES COC1C(C(OC1N2C=CC(=O)NC2=O)CO)O
InChIKey SXUXMRMBWZCMEN-ZOQUXTDFSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2'-O-Methyluridine (CAS: 2140-76-3)?

2'-O-Methyluridine is primarily used in the synthesis of RNA analogs, as a component in molecular bi...

Compound Q&A

Is 2'-O-Methyluridine (CAS: 2140-76-3) safe?

2'-O-Methyluridine is generally considered safe when handled properly in laboratory and industrial s...

Compound Q&A

How should 2'-O-Methyluridine (CAS: 2140-76-3) be stored?

2'-O-Methyluridine should be stored in a cool, dry place away from direct light. It is typically kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...