Compound Q&A

What are the main uses of 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0)?

Answer

1-Methyl-1H-indazole-3-carboxylic acid
1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in organic synthesis, materials science, and as an intermediate in the production of various chemicals. Its unique structure makes it valuable in the design of bioactive molecules and functional materials.

About

CAS No 50890-83-0
English Name 1-Methyl-1H-indazole-3-carboxylic acid
Molecular Formula C9H8N2O2
Molecular Weight 176.17 g/mol
SMILES CN1C2=CC=CC=C2C(=N1)C(=O)O
InChIKey OVVDFORZEGKEJM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0)?

1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) is a heterocyclic organic compound with the...

Compound Q&A

Is 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) safe?

1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) is generally considered safe when handled p...

Compound Q&A

How should 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) be stored?

1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) should be stored in a cool, dry, and well-v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...