Compound Q&A

What is 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0)?

Answer

1-Methyl-1H-indazole-3-carboxylic acid
1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) is a heterocyclic organic compound with the chemical formula C10H9N2O2. It contains an indazole ring system and a carboxylic acid group. This compound is known for its aromatic structure and is often used in chemical synthesis due to its reactivity and functional group versatility.

About

CAS No 50890-83-0
English Name 1-Methyl-1H-indazole-3-carboxylic acid
Molecular Formula C9H8N2O2
Molecular Weight 176.17 g/mol
SMILES CN1C2=CC=CC=C2C(=N1)C(=O)O
InChIKey OVVDFORZEGKEJM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0)?

1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) is primarily used in pharmaceutical researc...

Compound Q&A

Is 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) safe?

1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) is generally considered safe when handled p...

Compound Q&A

How should 1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) be stored?

1-Methyl-1H-indazole-3-carboxylic acid (CAS: 50890-83-0) should be stored in a cool, dry, and well-v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...