Compound Q&A

How should 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) be stored?

Answer

3-Methyl-8-quinolinesulfonyl chloride
3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) should be stored in a cool, dry place at 2-8°C, protected from light. Keep it in a sealed, airtight container made of glass or plastic to prevent moisture absorption. Avoid storage near strong bases or reducing agents. Ensure proper labeling and follow recommended storage conditions for chemical stability and safety.

About

CAS No 74863-82-4
English Name 3-Methyl-8-quinolinesulfonyl chloride
Molecular Formula C10H8ClNO2S
Molecular Weight 241.7 g/mol
SMILES CC1=CC2=C(C(=CC=C2)S(=O)(=O)Cl)N=C1
InChIKey XCMAYGDQKTWICK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4)?

3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) is an organic compound with the chemical for...

Compound Q&A

What are the main uses of 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4)?

3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) is primarily utilized in pharmaceutical rese...

Compound Q&A

Is 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) safe?

3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) requires caution due to its potential irrita...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...