Compound Q&A

What are the main uses of 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4)?

Answer

3-Methyl-8-quinolinesulfonyl chloride
3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) is primarily utilized in pharmaceutical research for the development of antifungal and anti-inflammatory drugs. It also serves as an industrial chemical in the synthesis of dyes, pesticides, and other specialty compounds. Its versatility makes it a key component in organic chemistry applications, particularly in drug discovery and chemical manufacturing.

About

CAS No 74863-82-4
English Name 3-Methyl-8-quinolinesulfonyl chloride
Molecular Formula C10H8ClNO2S
Molecular Weight 241.7 g/mol
SMILES CC1=CC2=C(C(=CC=C2)S(=O)(=O)Cl)N=C1
InChIKey XCMAYGDQKTWICK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4)?

3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) is an organic compound with the chemical for...

Compound Q&A

Is 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) safe?

3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) requires caution due to its potential irrita...

Compound Q&A

How should 3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) be stored?

3-Methyl-8-quinolinesulfonyl chloride (CAS: 74863-82-4) should be stored in a cool, dry place at 2-8...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...