Compound Q&A

Is 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) safe?

Answer

2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate
2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) is generally considered safe when handled properly. However, as with many organic compounds, it is advisable to take standard safety precautions, such as wearing gloves and goggles, and ensuring proper ventilation. Safety data sheets (SDS) should be consulted for specific handling and disposal guidelines.

About

English Name 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate
Molecular Formula C13H22O5
Molecular Weight 258.31 g/mol
SMILES CC1(OC(CC(O1)C=O)CC(=O)OC(C)(C)C)C
InChIKey JEFQIIXBSQLRTF-ZJUUUORDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4)?

2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) is a sy...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4)?

This compound is primarily used in pharmaceutical research for the synthesis of various biologically...

Compound Q&A

How should 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) be stored?

This compound should be stored in a cool, dry, and well-ventilated place, away from direct light. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...