Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4)?

Answer

2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate
This compound is primarily used in pharmaceutical research for the synthesis of various biologically active molecules. It also finds applications in organic chemistry as a building block for more complex structures. Additionally, it is used in the development of specialty chemicals and in academic studies related to carbohydrate chemistry and glycosylation processes.

About

English Name 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate
Molecular Formula C13H22O5
Molecular Weight 258.31 g/mol
SMILES CC1(OC(CC(O1)C=O)CC(=O)OC(C)(C)C)C
InChIKey JEFQIIXBSQLRTF-ZJUUUORDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4)?

2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) is a sy...

Compound Q&A

Is 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) safe?

2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) is gene...

Compound Q&A

How should 2-Methyl-2-propanyl 3,5-dideoxy-2,4-O-isopropylidene-L-erythro-hexuronate (CAS: 124752-23-4) be stored?

This compound should be stored in a cool, dry, and well-ventilated place, away from direct light. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...