Compound Q&A

Is 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) safe?

Answer

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid
2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) is generally considered safe when handled properly. However, it is important to follow standard safety protocols, such as wearing personal protective equipment (PPE) and ensuring proper ventilation. As with many organic compounds, it may pose risks if ingested or inhaled, so adherence to safety guidelines is essential in laboratory and industrial settings.

About

CAS No 68767-14-6
English Name 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid
Molecular Formula C15H18O3
Molecular Weight 246.31 g/mol
SMILES CC(C1=CC=C(C=C1)CC2CCCC2=O)C(=O)O
InChIKey YMBXTVYHTMGZDW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6)?

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) is an organic compound charac...

Compound Q&A

What are the main uses of 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6)?

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) is primarily used in pharmace...

Compound Q&A

How should 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) be stored?

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...