Compound Q&A

What are the main uses of 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6)?

Answer

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid
2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) is primarily used in pharmaceutical research for the development of potential drug candidates. It is also employed in organic synthesis as an intermediate. Additionally, it can be used in industrial applications for the production of specialty chemicals and in research settings for studying molecular interactions and biological effects.

About

CAS No 68767-14-6
English Name 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid
Molecular Formula C15H18O3
Molecular Weight 246.31 g/mol
SMILES CC(C1=CC=C(C=C1)CC2CCCC2=O)C(=O)O
InChIKey YMBXTVYHTMGZDW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6)?

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) is an organic compound charac...

Compound Q&A

Is 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) safe?

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) is generally considered safe ...

Compound Q&A

How should 2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) be stored?

2-{4-[(2-Oxocyclopentyl)methyl]phenyl}propanoic acid (CAS: 68767-14-6) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...