Compound Q&A

How should Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) be stored?

Answer

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)-
Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) should be stored in a cool, dry place, away from light and moisture. Keep in airtight containers to prevent degradation. Avoid exposure to air and heat, and ensure proper labeling to maintain stability and safety during storage.

About

CAS No 14324-55-1
English Name Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)-
Molecular Formula C10H20N2S4Zn
Molecular Weight 361.92 g/mol
SMILES CCN(C(=S)[S-])CC.CCN(C(=S)[S-])CC.[Zn+2]
InChIKey RKQOSDAEEGPRER-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1)?

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) is a coordination compound feat...

Compound Q&A

What are the main uses of Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1)?

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) is primarily used as a catalyst...

Compound Q&A

Is Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) safe?

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) is generally considered safe wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...