Compound Q&A

What are the main uses of Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1)?

Answer

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)-
Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) is primarily used as a catalyst in organic synthesis, a stabilizer in polymer production, and a reagent in pharmaceutical research. It also finds applications in agricultural chemicals and as a precursor for other zinc-containing compounds. Its versatility makes it valuable in various industrial and scientific processes.

About

CAS No 14324-55-1
English Name Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)-
Molecular Formula C10H20N2S4Zn
Molecular Weight 361.92 g/mol
SMILES CCN(C(=S)[S-])CC.CCN(C(=S)[S-])CC.[Zn+2]
InChIKey RKQOSDAEEGPRER-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1)?

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) is a coordination compound feat...

Compound Q&A

Is Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) safe?

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) is generally considered safe wh...

Compound Q&A

How should Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) be stored?

Zinc, bis(diethylcarbamodithioato-kS,kS')-, (T-4)- (CAS: 14324-55-1) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...